C33H50N2O7S — CID 10603895
tert-butyl (10S)-11-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-11-oxo-10-(phenylmethoxycarbonylamino)undecanoate (PubChem CID 10603895) has the molecular formula C33H50N2O7S and a molecular weight of 618.84 g/mol. Its IUPAC name is tert-butyl (10S)-11-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-11-oxo-10-(phenylmethoxycarbonylamino)undecanoate.
| Compound Name | tert-butyl (10S)-11-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-11-oxo-10-(phenylmethoxycarbonylamino)undecanoate |
|---|---|
| PubChem CID | 10603895 |
| Molecular Formula | C33H50N2O7S |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | tert-butyl (10S)-11-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-11-oxo-10-(phenylmethoxycarbonylamino)undecanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C33H50N2O7S/c1-31(2,3)42-28(36)18-14-9-7-6-8-13-17-26(34-30(38)41-22-24-15-11-10-12-16-24)29(37)35-27-21-25-19-20-33(27,32(25,4)5)23-43(35,39)40/h10-12,15-16,25-27H,6-9,13-14,17-23H2,1-5H3,(H,34,38)/t25-,26+,27-,33-/m1/s1 |
| InChIKey | DEGXLDMTYDCZPJ-GLPSKGHJSA-N |
| XLogP | 6.11 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|