C27H21ClFNO — CID 141325091
(3R)-1-(5-chloro-2-fluoro-4-pyridinyl)-3-(2-methylphenyl)-3-(4-phenylphenyl)propan-1-one (PubChem CID 141325091) has the molecular formula C27H21ClFNO and a molecular weight of 429.92 g/mol. Its IUPAC name is (3R)-1-(5-chloro-2-fluoro-4-pyridinyl)-3-(2-methylphenyl)-3-(4-phenylphenyl)propan-1-one.
| Compound Name | (3R)-1-(5-chloro-2-fluoro-4-pyridinyl)-3-(2-methylphenyl)-3-(4-phenylphenyl)propan-1-one |
|---|---|
| PubChem CID | 141325091 |
| Molecular Formula | C27H21ClFNO |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3R)-1-(5-chloro-2-fluoro-4-pyridinyl)-3-(2-methylphenyl)-3-(4-phenylphenyl)propan-1-one |
| SMILES | Cc1ccccc1[C@H](CC(=O)c1cc(F)ncc1Cl)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21ClFNO/c1-18-7-5-6-10-22(18)23(15-26(31)24-16-27(29)30-17-25(24)28)21-13-11-20(12-14-21)19-8-3-2-4-9-19/h2-14,16-17,23H,15H2,1H3/t23-/m1/s1 |
| InChIKey | RTLGBRVTKGLYBD-HSZRJFAPSA-N |
| XLogP | 7.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|