C39H48O8 — CID 141325777
[3-methyl-4-[4-[1-[(E)-prop-1-enoxy]hexoxy]benzoyl]oxyphenyl] 4-[1-[(E)-prop-1-enoxy]hexoxy]benzoate (PubChem CID 141325777) has the molecular formula C39H48O8 and a molecular weight of 644.80 g/mol. Its IUPAC name is [3-methyl-4-[4-[1-[(E)-prop-1-enoxy]hexoxy]benzoyl]oxyphenyl] 4-[1-[(E)-prop-1-enoxy]hexoxy]benzoate.
| Compound Name | [3-methyl-4-[4-[1-[(E)-prop-1-enoxy]hexoxy]benzoyl]oxyphenyl] 4-[1-[(E)-prop-1-enoxy]hexoxy]benzoate |
|---|---|
| PubChem CID | 141325777 |
| Molecular Formula | C39H48O8 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | [3-methyl-4-[4-[1-[(E)-prop-1-enoxy]hexoxy]benzoyl]oxyphenyl] 4-[1-[(E)-prop-1-enoxy]hexoxy]benzoate |
| SMILES | C/C=C/OC(CCCCC)Oc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(CCCCC)O/C=C/C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C39H48O8/c1-6-10-12-14-36(42-26-8-3)44-32-20-16-30(17-21-32)38(40)46-34-24-25-35(29(5)28-34)47-39(41)31-18-22-33(23-19-31)45-37(43-27-9-4)15-13-11-7-2/h8-9,16-28,36-37H,6-7,10-15H2,1-5H3/b26-8+,27-9+ |
| InChIKey | GMHJZMQIUBOMGP-NBWJZYFFSA-N |
| XLogP | 10.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|