C4F7N3 — CID 141339569
1-azido-1,2,2,3,3,4,4-heptafluorocyclobutane (PubChem CID 141339569) has the molecular formula C4F7N3 and a molecular weight of 223.05 g/mol. Its IUPAC name is 1-azido-1,2,2,3,3,4,4-heptafluorocyclobutane.
| Compound Name | 1-azido-1,2,2,3,3,4,4-heptafluorocyclobutane |
|---|---|
| PubChem CID | 141339569 |
| Molecular Formula | C4F7N3 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 1-azido-1,2,2,3,3,4,4-heptafluorocyclobutane |
| SMILES | [N-]=[N+]=NC1(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F7N3/c5-1(6)2(7,8)4(11,13-14-12)3(1,9)10 |
| InChIKey | IZVHFVLXJOGAHV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|