C8N24 — CID 86068783
1,2,3,4,5,6,7,8-octaazidocubane (PubChem CID 86068783) has the molecular formula C8N24 and a molecular weight of 432.26 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octaazidocubane.
| Compound Name | 1,2,3,4,5,6,7,8-octaazidocubane |
|---|---|
| PubChem CID | 86068783 |
| Molecular Formula | C8N24 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octaazidocubane |
| SMILES | [N-]=[N+]=NC12C3(N=[N+]=[N-])C4(N=[N+]=[N-])C1(N=[N+]=[N-])C1(N=[N+]=[N-])C2(N=[N+]=[N-])C3(N=[N+]=[N-])C41N=[N+]=[N-] |
| InChI | InChI=1S/C8N24/c9-25-17-1-2(18-26-10)5(21-29-13)3(1,19-27-11)7(23-31-15)4(1,20-28-12)6(2,22-30-14)8(5,7)24-32-16 |
| InChIKey | FEOXETXHOXNPJQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 390.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|