C6H9N3 — CID 131187728
cis-(1S,2S)-1-azido-1-ethenyl-2-methylcyclopropane (PubChem CID 131187728) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is cis-(1S,2S)-1-azido-1-ethenyl-2-methylcyclopropane.
| Compound Name | cis-(1S,2S)-1-azido-1-ethenyl-2-methylcyclopropane |
|---|---|
| PubChem CID | 131187728 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | cis-(1S,2S)-1-azido-1-ethenyl-2-methylcyclopropane |
| SMILES | C=C[C@@]1(N=[N+]=[N-])C[C@@H]1C |
| InChI | InChI=1S/C6H9N3/c1-3-6(8-9-7)4-5(6)2/h3,5H,1,4H2,2H3/t5-,6+/m0/s1 |
| InChIKey | VXTVAURSZGGACU-NTSWFWBYSA-N |
| XLogP | 2.26 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|