About sodium hex-4-ynoate
sodium hex-4-ynoate (PubChem CID 141345346) has the molecular formula C6H7NaO2
and a molecular weight of 134.11 g/mol. Its IUPAC name is sodium hex-4-ynoate.
Molecular Properties
| Compound Name | sodium hex-4-ynoate |
| PubChem CID | 141345346 |
| Molecular Formula | C6H7NaO2 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | sodium hex-4-ynoate |
| SMILES | CC#CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h4-5H2,1H3,(H,7,8);/q;+1/p-1 |
| InChIKey | PHJBPUOMPGQKEB-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium hex-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium hex-4-ynoate?
The IUPAC name of sodium hex-4-ynoate (CID 141345346) is sodium hex-4-ynoate.
What is the SMILES notation for sodium hex-4-ynoate?
The canonical SMILES for sodium hex-4-ynoate is CC#CCCC(=O)[O-].[Na+].
What is the InChIKey of sodium hex-4-ynoate?
The InChIKey is PHJBPUOMPGQKEB-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h4-5H2,1H3,(H,7,8);/q;+1/p-1.
What are the key properties of sodium hex-4-ynoate?
sodium hex-4-ynoate has a molecular weight of 134.11 g/mol, XLogP of -3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hex-4-ynoate is sourced from PubChem (CID 141345346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).