C6H9BrO2 — CID 141346304
3-bromo-2-ethoxy-2,5-dihydrofuran (PubChem CID 141346304) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is 3-bromo-2-ethoxy-2,5-dihydrofuran.
| Compound Name | 3-bromo-2-ethoxy-2,5-dihydrofuran |
|---|---|
| PubChem CID | 141346304 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | 3-bromo-2-ethoxy-2,5-dihydrofuran |
| SMILES | CCOC1OCC=C1Br |
| InChI | InChI=1S/C6H9BrO2/c1-2-8-6-5(7)3-4-9-6/h3,6H,2,4H2,1H3 |
| InChIKey | CASOPHUYDNULGQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |