C30H27N3O7 — CID 141347480
2-acetyloxy-3-[2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl]benzoic acid (PubChem CID 141347480) has the molecular formula C30H27N3O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-acetyloxy-3-[2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl]benzoic acid.
| Compound Name | 2-acetyloxy-3-[2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl]benzoic acid |
|---|---|
| PubChem CID | 141347480 |
| Molecular Formula | C30H27N3O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-acetyloxy-3-[2-[4-(3-ethynylanilino)-6-(2-methoxyethoxy)quinazolin-7-yl]oxyethyl]benzoic acid |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCc4cccc(C(=O)O)c4OC(C)=O)c(OCCOC)cc23)c1 |
| InChI | InChI=1S/C30H27N3O7/c1-4-20-7-5-9-22(15-20)33-29-24-16-26(39-14-13-37-3)27(17-25(24)31-18-32-29)38-12-11-21-8-6-10-23(30(35)36)28(21)40-19(2)34/h1,5-10,15-18H,11-14H2,2-3H3,(H,35,36)(H,31,32,33) |
| InChIKey | KNAKFAVMEVDWCI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 129.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|