C13H18O5 — CID 141348211
3,3-diacetylnonane-2,4,8-trione (PubChem CID 141348211) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 3,3-diacetylnonane-2,4,8-trione.
| Compound Name | 3,3-diacetylnonane-2,4,8-trione |
|---|---|
| PubChem CID | 141348211 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3,3-diacetylnonane-2,4,8-trione |
| SMILES | CC(=O)CCCC(=O)C(C(C)=O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C13H18O5/c1-8(14)6-5-7-12(18)13(9(2)15,10(3)16)11(4)17/h5-7H2,1-4H3 |
| InChIKey | ZNVJMHGBFNIIJL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|