C15H13ClN2O — CID 141349087
4-(4-chloro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline (PubChem CID 141349087) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 4-(4-chloro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(4-chloro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 141349087 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-(4-chloro-1,3-benzoxazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3c(Cl)cccc3o2)cc1 |
| InChI | InChI=1S/C15H13ClN2O/c1-18(2)11-8-6-10(7-9-11)15-17-14-12(16)4-3-5-13(14)19-15/h3-9H,1-2H3 |
| InChIKey | ZDCSDOZLCBDNLA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|