C24H18ClF3N2O5S — CID 141351212
N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 141351212) has the molecular formula C24H18ClF3N2O5S and a molecular weight of 538.93 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141351212 |
| Molecular Formula | C24H18ClF3N2O5S |
| Molecular Weight | 538.93 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]methyl]-5-[(1,3-dioxoisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)c3ccccc3C2=O)cc1S(=O)(=O)NCc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C24H18ClF3N2O5S/c1-35-20-9-6-14(13-30-22(31)17-4-2-3-5-18(17)23(30)32)10-21(20)36(33,34)29-12-15-11-16(24(26,27)28)7-8-19(15)25/h2-11,29H,12-13H2,1H3 |
| InChIKey | QBYVLLLCPUUIOU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.93 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|