C22H30O5 — CID 141353357
(2-cyclooctyloxy-2-oxoethyl) 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate (PubChem CID 141353357) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (2-cyclooctyloxy-2-oxoethyl) 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate.
| Compound Name | (2-cyclooctyloxy-2-oxoethyl) 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 141353357 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2-cyclooctyloxy-2-oxoethyl) 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
| SMILES | O=C(COC(=O)C1CC2OC1C1C3C=CC(C3)C21)OC1CCCCCCC1 |
| InChI | InChI=1S/C22H30O5/c23-18(26-15-6-4-2-1-3-5-7-15)12-25-22(24)16-11-17-19-13-8-9-14(10-13)20(19)21(16)27-17/h8-9,13-17,19-21H,1-7,10-12H2 |
| InChIKey | SAEMXTHMSNKGDO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|