C23H30O4 — CID 141353333
1-adamantyloxymethyl 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate (PubChem CID 141353333) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-adamantyloxymethyl 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate.
| Compound Name | 1-adamantyloxymethyl 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
|---|---|
| PubChem CID | 141353333 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-adamantyloxymethyl 11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9-carboxylate |
| SMILES | O=C(OCOC12CC3CC(CC(C3)C1)C2)C1CC2OC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C23H30O4/c24-22(17-7-18-19-15-1-2-16(6-15)20(19)21(17)27-18)25-11-26-23-8-12-3-13(9-23)5-14(4-12)10-23/h1-2,12-21H,3-11H2 |
| InChIKey | FRMCKRNVWVLXOX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|