C25H28O6 — CID 172746473
[2-(1-adamantyloxy)-2-oxoethyl] 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 172746473) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is [2-(1-adamantyloxy)-2-oxoethyl] 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | [2-(1-adamantyloxy)-2-oxoethyl] 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 172746473 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [2-(1-adamantyloxy)-2-oxoethyl] 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C(COC(=O)C1CC2C(=O)C1C1C3C=CC(C3=O)C21)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H28O6/c26-18(31-25-7-11-3-12(8-25)5-13(4-11)9-25)10-30-24(29)17-6-16-19-14-1-2-15(22(14)27)20(19)21(17)23(16)28/h1-2,11-17,19-21H,3-10H2 |
| InChIKey | JUFSLOPQTZKKTH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|