C24H28O5 — CID 172801801
2-adamantyloxymethyl 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 172801801) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 2-adamantyloxymethyl 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | 2-adamantyloxymethyl 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 172801801 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-adamantyloxymethyl 11,12-dioxotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | O=C1C2C=CC1C1C3C(=O)C(CC3C(=O)OCOC3C4CC5CC(C4)CC3C5)C21 |
| InChI | InChI=1S/C24H28O5/c25-21-14-1-2-15(21)19-18(14)16-8-17(20(19)22(16)26)24(27)29-9-28-23-12-4-10-3-11(6-12)7-13(23)5-10/h1-2,10-20,23H,3-9H2 |
| InChIKey | QYUHXUQHJWDCQY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|