C24H32O5 — CID 172740892
[2-[2-(1-adamantyl)butan-2-yloxy]-2-oxoethyl] 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 172740892) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [2-[2-(1-adamantyl)butan-2-yloxy]-2-oxoethyl] 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-[2-(1-adamantyl)butan-2-yloxy]-2-oxoethyl] 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 172740892 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [2-[2-(1-adamantyl)butan-2-yloxy]-2-oxoethyl] 7-oxobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC(C)(OC(=O)COC(=O)C1CC2C=CC1C2=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32O5/c1-3-23(2,24-10-14-6-15(11-24)8-16(7-14)12-24)29-20(25)13-28-22(27)19-9-17-4-5-18(19)21(17)26/h4-5,14-19H,3,6-13H2,1-2H3 |
| InChIKey | JBUZDFLQBXATJC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|