C35H58O7 — CID 91574979
2-O-[2-[2-(1-adamantyl)propan-2-yloxy]-2-oxoethyl] 1-O-[2-(2,3,3-trimethyl-2-propan-2-ylbutoxy)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 91574979) has the molecular formula C35H58O7 and a molecular weight of 590.84 g/mol. Its IUPAC name is 2-O-[2-[2-(1-adamantyl)propan-2-yloxy]-2-oxoethyl] 1-O-[2-(2,3,3-trimethyl-2-propan-2-ylbutoxy)ethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-[2-[2-(1-adamantyl)propan-2-yloxy]-2-oxoethyl] 1-O-[2-(2,3,3-trimethyl-2-propan-2-ylbutoxy)ethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91574979 |
| Molecular Formula | C35H58O7 |
| Molecular Weight | 590.84 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | 2-O-[2-[2-(1-adamantyl)propan-2-yloxy]-2-oxoethyl] 1-O-[2-(2,3,3-trimethyl-2-propan-2-ylbutoxy)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)C(C)(COCCOC(=O)C1CCCCC1C(=O)OCC(=O)OC(C)(C)C12CC3CC(CC(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C35H58O7/c1-23(2)34(8,32(3,4)5)22-39-13-14-40-30(37)27-11-9-10-12-28(27)31(38)41-21-29(36)42-33(6,7)35-18-24-15-25(19-35)17-26(16-24)20-35/h23-28H,9-22H2,1-8H3 |
| InChIKey | NYHCPRWBCVRULB-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.84 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|