C16H22O3 — CID 141353375
5-(11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl)pentanoic acid (PubChem CID 141353375) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl)pentanoic acid.
| Compound Name | 5-(11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl)pentanoic acid |
|---|---|
| PubChem CID | 141353375 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5-(11-oxatetracyclo[6.2.1.13,6.02,7]dodec-4-en-9-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1CC2OC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C16H22O3/c17-13(18)4-2-1-3-11-8-12-14-9-5-6-10(7-9)15(14)16(11)19-12/h5-6,9-12,14-16H,1-4,7-8H2,(H,17,18) |
| InChIKey | RKTPBWAJFWGCRP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|