C15H22O4 — CID 102246913
2-[(2R,3S)-3-[(1S,2S,3R,4R)-3-[(2S,3R)-3-(2-hydroxyethyl)oxiran-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]oxiran-2-yl]ethanol (PubChem CID 102246913) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(2R,3S)-3-[(1S,2S,3R,4R)-3-[(2S,3R)-3-(2-hydroxyethyl)oxiran-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]oxiran-2-yl]ethanol.
| Compound Name | 2-[(2R,3S)-3-[(1S,2S,3R,4R)-3-[(2S,3R)-3-(2-hydroxyethyl)oxiran-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]oxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 102246913 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[(2R,3S)-3-[(1S,2S,3R,4R)-3-[(2S,3R)-3-(2-hydroxyethyl)oxiran-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]oxiran-2-yl]ethanol |
| SMILES | OCC[C@H]1O[C@H]1[C@@H]1[C@H]([C@@H]2O[C@@H]2CCO)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H22O4/c16-5-3-10-14(18-10)12-8-1-2-9(7-8)13(12)15-11(19-15)4-6-17/h1-2,8-17H,3-7H2/t8-,9+,10-,11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | MDZDLHXJJOHOEE-VVWCXJRCSA-N |
| XLogP | 0.72 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|