C20H21N5O3 — CID 1413542
1-[(3aS,7aR)-3a,7a-dicyano-3,3-dimethoxy-6-methyl-4,7-dihydroisoindol-1-yl]-3-phenylurea (PubChem CID 1413542) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3a,7a-dicyano-3,3-dimethoxy-6-methyl-4,7-dihydroisoindol-1-yl]-3-phenylurea.
| Compound Name | 1-[(3aS,7aR)-3a,7a-dicyano-3,3-dimethoxy-6-methyl-4,7-dihydroisoindol-1-yl]-3-phenylurea |
|---|---|
| PubChem CID | 1413542 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[(3aS,7aR)-3a,7a-dicyano-3,3-dimethoxy-6-methyl-4,7-dihydroisoindol-1-yl]-3-phenylurea |
| SMILES | COC1(OC)N=C(NC(=O)Nc2ccccc2)[C@]2(C#N)CC(C)=CC[C@]12C#N |
| InChI | InChI=1S/C20H21N5O3/c1-14-9-10-19(13-22)18(11-14,12-21)16(25-20(19,27-2)28-3)24-17(26)23-15-7-5-4-6-8-15/h4-9H,10-11H2,1-3H3,(H2,23,24,25,26)/t18-,19-/m1/s1 |
| InChIKey | HZGITHFKISNJSP-RTBURBONSA-N |
| XLogP | 2.93 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|