C21H29N7 — CID 141355599
N-[2-[4-(5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaen-13-yl)piperidin-1-yl]ethyl]piperidin-4-amine (PubChem CID 141355599) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[2-[4-(5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaen-13-yl)piperidin-1-yl]ethyl]piperidin-4-amine.
| Compound Name | N-[2-[4-(5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaen-13-yl)piperidin-1-yl]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 141355599 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | N-[2-[4-(5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,5,7,9,11-hexaen-13-yl)piperidin-1-yl]ethyl]piperidin-4-amine |
| SMILES | c1cc2c(n1)ncc1cncn(C3CCN(CCNC4CCNCC4)CC3)c12 |
| InChI | InChI=1S/C21H29N7/c1-6-22-7-2-17(1)24-9-12-27-10-4-18(5-11-27)28-15-23-13-16-14-26-21-19(20(16)28)3-8-25-21/h3,8,13-15,17-18,22,24H,1-2,4-7,9-12H2 |
| InChIKey | UMRWCOKTRKSPLC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |