C18H26N6 — CID 143464867
(1E)-N,N-dimethyl-2-(9-piperidin-4-ylimino-2,8-dihydropyrazino[1,2-a]pyrimidin-4-yl)buta-1,3-dien-1-amine (PubChem CID 143464867) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is (1E)-N,N-dimethyl-2-(9-piperidin-4-ylimino-2,8-dihydropyrazino[1,2-a]pyrimidin-4-yl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-N,N-dimethyl-2-(9-piperidin-4-ylimino-2,8-dihydropyrazino[1,2-a]pyrimidin-4-yl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143464867 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (1E)-N,N-dimethyl-2-(9-piperidin-4-ylimino-2,8-dihydropyrazino[1,2-a]pyrimidin-4-yl)buta-1,3-dien-1-amine |
| SMILES | C=C/C(=C\N(C)C)C1=CCN=C2/C(=N/C3CCNCC3)NC=CN12 |
| InChI | InChI=1S/C18H26N6/c1-4-14(13-23(2)3)16-7-10-21-18-17(20-11-12-24(16)18)22-15-5-8-19-9-6-15/h4,7,11-13,15,19H,1,5-6,8-10H2,2-3H3,(H,20,22)/b14-13+ |
| InChIKey | CNOZSDDRBOESIH-BUHFOSPRSA-N |
| XLogP | 1.44 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|