C15H25N3Sn — CID 141360208
[4-[(diaminomethylideneamino)methyl]phenyl]-(3-ethylpentan-3-yl)tin (PubChem CID 141360208) has the molecular formula C15H25N3Sn and a molecular weight of 366.10 g/mol. Its IUPAC name is [4-[(diaminomethylideneamino)methyl]phenyl]-(3-ethylpentan-3-yl)tin.
| Compound Name | [4-[(diaminomethylideneamino)methyl]phenyl]-(3-ethylpentan-3-yl)tin |
|---|---|
| PubChem CID | 141360208 |
| Molecular Formula | C15H25N3Sn |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [4-[(diaminomethylideneamino)methyl]phenyl]-(3-ethylpentan-3-yl)tin |
| SMILES | CCC(CC)(CC)[Sn]c1ccc(CN=C(N)N)cc1 |
| InChI | InChI=1S/C8H10N3.C7H15.Sn/c9-8(10)11-6-7-4-2-1-3-5-7;1-4-7(5-2)6-3;/h2-5H,6H2,(H4,9,10,11);4-6H2,1-3H3; |
| InChIKey | BFIJKNHGYKEXDV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|