C22H27N3O5 — CID 141365885
[2-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)anilino]-2-hydroxyethyl] acetate (PubChem CID 141365885) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)anilino]-2-hydroxyethyl] acetate.
| Compound Name | [2-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)anilino]-2-hydroxyethyl] acetate |
|---|---|
| PubChem CID | 141365885 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [2-[2-carbamoyl-5-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)anilino]-2-hydroxyethyl] acetate |
| SMILES | CC(=O)OCC(O)Nc1cc(-n2cc(C)c3c2CC(C)(C)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C22H27N3O5/c1-12-10-25(17-8-22(3,4)9-18(27)20(12)17)14-5-6-15(21(23)29)16(7-14)24-19(28)11-30-13(2)26/h5-7,10,19,24,28H,8-9,11H2,1-4H3,(H2,23,29) |
| InChIKey | DZLCHQNHBPHRIU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|