C22H28N2O3 — CID 58139456
2-(3-methoxypropyl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (PubChem CID 58139456) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide.
| Compound Name | 2-(3-methoxypropyl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
|---|---|
| PubChem CID | 58139456 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-(3-methoxypropyl)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| SMILES | COCCCc1cc(-n2cc(C)c3c2CC(C)(C)CC3=O)ccc1C(N)=O |
| InChI | InChI=1S/C22H28N2O3/c1-14-13-24(18-11-22(2,3)12-19(25)20(14)18)16-7-8-17(21(23)26)15(10-16)6-5-9-27-4/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H2,23,26) |
| InChIKey | YDWAYXHLBBHJBV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|