C21H22N4O3 — CID 59213803
1-amino-N-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboxamide (PubChem CID 59213803) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-amino-N-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-amino-N-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 59213803 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-amino-N-hydroxy-6-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)isoquinoline-4-carboxamide |
| SMILES | Cc1cn(-c2ccc3c(N)ncc(C(=O)NO)c3c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C21H22N4O3/c1-11-10-25(16-7-21(2,3)8-17(26)18(11)16)12-4-5-13-14(6-12)15(20(27)24-28)9-23-19(13)22/h4-6,9-10,28H,7-8H2,1-3H3,(H2,22,23)(H,24,27) |
| InChIKey | HUWIZJXKIKTFAZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|