C13H7Cl4NO2 — CID 141384323
(2-aminophenyl)-(2,3,4,5-tetrachloro-6-hydroxyphenyl)methanone (PubChem CID 141384323) has the molecular formula C13H7Cl4NO2 and a molecular weight of 351.02 g/mol. Its IUPAC name is (2-aminophenyl)-(2,3,4,5-tetrachloro-6-hydroxyphenyl)methanone.
| Compound Name | (2-aminophenyl)-(2,3,4,5-tetrachloro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 141384323 |
| Molecular Formula | C13H7Cl4NO2 |
| Molecular Weight | 351.02 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | (2-aminophenyl)-(2,3,4,5-tetrachloro-6-hydroxyphenyl)methanone |
| SMILES | Nc1ccccc1C(=O)c1c(O)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H7Cl4NO2/c14-8-7(13(20)11(17)10(16)9(8)15)12(19)5-3-1-2-4-6(5)18/h1-4,20H,18H2 |
| InChIKey | PDHNBUJSWUKVCQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.02 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|