C22H36ClN3O4Si — CID 141384913
ethyl 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-chlorophenyl]-2-oxoimidazolidin-1-yl]propanoate (PubChem CID 141384913) has the molecular formula C22H36ClN3O4Si and a molecular weight of 470.09 g/mol. Its IUPAC name is ethyl 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-chlorophenyl]-2-oxoimidazolidin-1-yl]propanoate.
| Compound Name | ethyl 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-chlorophenyl]-2-oxoimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 141384913 |
| Molecular Formula | C22H36ClN3O4Si |
| Molecular Weight | 470.09 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | ethyl 2-[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-2-chlorophenyl]-2-oxoimidazolidin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1CCN(c2ccc(NCCO[Si](C)(C)C(C)(C)C)cc2Cl)C1=O |
| InChI | InChI=1S/C22H36ClN3O4Si/c1-8-29-20(27)16(2)25-12-13-26(21(25)28)19-10-9-17(15-18(19)23)24-11-14-30-31(6,7)22(3,4)5/h9-10,15-16,24H,8,11-14H2,1-7H3 |
| InChIKey | SZCKXRKMLJDZFY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.09 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|