C50H47ClO8 — CID 141390132
(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-phenylmethoxyphenyl)methyl]phenyl]-6,8-dihydroxy-2,3,4-tris(phenylmethoxy)bicyclo[3.2.1]octane-1-carboxylic acid (PubChem CID 141390132) has the molecular formula C50H47ClO8 and a molecular weight of 811.37 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-phenylmethoxyphenyl)methyl]phenyl]-6,8-dihydroxy-2,3,4-tris(phenylmethoxy)bicyclo[3.2.1]octane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-phenylmethoxyphenyl)methyl]phenyl]-6,8-dihydroxy-2,3,4-tris(phenylmethoxy)bicyclo[3.2.1]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 141390132 |
| Molecular Formula | C50H47ClO8 |
| Molecular Weight | 811.37 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-phenylmethoxyphenyl)methyl]phenyl]-6,8-dihydroxy-2,3,4-tris(phenylmethoxy)bicyclo[3.2.1]octane-1-carboxylic acid |
| SMILES | O=C(O)[C@@]12CC(O)[C@@](c3ccc(Cl)c(Cc4ccc(OCc5ccccc5)cc4)c3)(C1O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C50H47ClO8/c51-42-26-23-40(28-39(42)27-34-21-24-41(25-22-34)56-30-35-13-5-1-6-14-35)50-43(52)29-49(47(50)53,48(54)55)45(58-32-37-17-9-3-10-18-37)44(57-31-36-15-7-2-8-16-36)46(50)59-33-38-19-11-4-12-20-38/h1-26,28,43-47,52-53H,27,29-33H2,(H,54,55)/t43?,44-,45-,46+,47?,49-,50-/m1/s1 |
| InChIKey | HWZNVTJFGDGMLP-XSWXYGSTSA-N |
| XLogP | 8.71 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.37 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |