C17H14ClF2N3OS — CID 141391513
5-(2-chlorophenyl)-1-(2,4-difluorophenyl)-2-(oxiran-2-ylmethyl)-1,2,4-triazolidine-3-thione (PubChem CID 141391513) has the molecular formula C17H14ClF2N3OS and a molecular weight of 381.84 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1-(2,4-difluorophenyl)-2-(oxiran-2-ylmethyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5-(2-chlorophenyl)-1-(2,4-difluorophenyl)-2-(oxiran-2-ylmethyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 141391513 |
| Molecular Formula | C17H14ClF2N3OS |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 5-(2-chlorophenyl)-1-(2,4-difluorophenyl)-2-(oxiran-2-ylmethyl)-1,2,4-triazolidine-3-thione |
| SMILES | Fc1ccc(N2C(c3ccccc3Cl)NC(=S)N2CC2CO2)c(F)c1 |
| InChI | InChI=1S/C17H14ClF2N3OS/c18-13-4-2-1-3-12(13)16-21-17(25)22(8-11-9-24-11)23(16)15-6-5-10(19)7-14(15)20/h1-7,11,16H,8-9H2,(H,21,25) |
| InChIKey | LCPRQZVODBSPHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 31.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|