C16H15BrINO2S — CID 141393321
7-bromo-1-(4-iodo-1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonylindole (PubChem CID 141393321) has the molecular formula C16H15BrINO2S and a molecular weight of 492.18 g/mol. Its IUPAC name is 7-bromo-1-(4-iodo-1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonylindole.
| Compound Name | 7-bromo-1-(4-iodo-1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonylindole |
|---|---|
| PubChem CID | 141393321 |
| Molecular Formula | C16H15BrINO2S |
| Molecular Weight | 492.18 g/mol |
| Exact Mass | 490.91 |
| IUPAC Name | 7-bromo-1-(4-iodo-1,3-dimethylcyclohexa-2,4-dien-1-yl)sulfonylindole |
| SMILES | CC1=CC(C)(S(=O)(=O)n2ccc3cccc(Br)c32)CC=C1I |
| InChI | InChI=1S/C16H15BrINO2S/c1-11-10-16(2,8-6-14(11)18)22(20,21)19-9-7-12-4-3-5-13(17)15(12)19/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | BQUFHYFVTJNJPN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|