About 2-methoxybenzenethiol;sulfane
2-methoxybenzenethiol;sulfane (PubChem CID 141393821) has the molecular formula C7H10OS2
and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-methoxybenzenethiol;sulfane.
Molecular Properties
| Compound Name | 2-methoxybenzenethiol;sulfane |
| PubChem CID | 141393821 |
| Molecular Formula | C7H10OS2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 2-methoxybenzenethiol;sulfane |
| SMILES | COc1ccccc1S.S |
| InChI | InChI=1S/C7H8OS.H2S/c1-8-6-4-2-3-5-7(6)9;/h2-5,9H,1H3;1H2 |
| InChIKey | YWGWFMFHGVKWTI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzenethiol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzenethiol;sulfane?
The IUPAC name of 2-methoxybenzenethiol;sulfane (CID 141393821) is 2-methoxybenzenethiol;sulfane.
What is the SMILES notation for 2-methoxybenzenethiol;sulfane?
The canonical SMILES for 2-methoxybenzenethiol;sulfane is COc1ccccc1S.S.
What is the InChIKey of 2-methoxybenzenethiol;sulfane?
The InChIKey is YWGWFMFHGVKWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.H2S/c1-8-6-4-2-3-5-7(6)9;/h2-5,9H,1H3;1H2.
What are the key properties of 2-methoxybenzenethiol;sulfane?
2-methoxybenzenethiol;sulfane has a molecular weight of 174.29 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzenethiol;sulfane is sourced from PubChem (CID 141393821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).