C18H29N3O7 — CID 141395615
4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 141395615) has the molecular formula C18H29N3O7 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 141395615 |
| Molecular Formula | C18H29N3O7 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-methyl-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC1=C(C(=O)O)OCCC1N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N3O7/c1-10-11(8-9-26-12(10)13(22)23)19-14(20-15(24)27-17(2,3)4)21-16(25)28-18(5,6)7/h11H,8-9H2,1-7H3,(H,22,23)(H2,19,20,21,24,25) |
| InChIKey | PQDAXQMGBHSYGK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|