C12H22N4O — CID 141403331
3-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine (PubChem CID 141403331) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 3-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 141403331 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
| SMILES | CNc1cc(OC)c(N)c(CCN(C)C)c1N |
| InChI | InChI=1S/C12H22N4O/c1-15-9-7-10(17-4)12(14)8(11(9)13)5-6-16(2)3/h7,15H,5-6,13-14H2,1-4H3 |
| InChIKey | LZOYOMJPNZZRBZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|