C7H14F6N2O4S2 — CID 141403817
bis(trifluoromethylsulfonyl)azanide;ethyl(propyl)azanium (PubChem CID 141403817) has the molecular formula C7H14F6N2O4S2 and a molecular weight of 368.32 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;ethyl(propyl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;ethyl(propyl)azanium |
|---|---|
| PubChem CID | 141403817 |
| Molecular Formula | C7H14F6N2O4S2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;ethyl(propyl)azanium |
| SMILES | CCC[NH2+]CC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H13N.C2F6NO4S2/c1-3-5-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6H,3-5H2,1-2H3;/q;-1/p+1 |
| InChIKey | HPIOCVQLVPKXIO-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|