C18H19F2NO2 — CID 141404874
3-fluoro-1-(2-fluoro-5-methoxyphenyl)-4-phenoxypiperidine (PubChem CID 141404874) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 3-fluoro-1-(2-fluoro-5-methoxyphenyl)-4-phenoxypiperidine.
| Compound Name | 3-fluoro-1-(2-fluoro-5-methoxyphenyl)-4-phenoxypiperidine |
|---|---|
| PubChem CID | 141404874 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 3-fluoro-1-(2-fluoro-5-methoxyphenyl)-4-phenoxypiperidine |
| SMILES | COc1ccc(F)c(N2CCC(Oc3ccccc3)C(F)C2)c1 |
| InChI | InChI=1S/C18H19F2NO2/c1-22-14-7-8-15(19)17(11-14)21-10-9-18(16(20)12-21)23-13-5-3-2-4-6-13/h2-8,11,16,18H,9-10,12H2,1H3 |
| InChIKey | TXOBKZLQCVQFSO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |