C19H21FINO2 — CID 142726683
1-(2-fluoro-5-methoxyphenyl)-4-(4-iodophenoxy)-3-methylpiperidine (PubChem CID 142726683) has the molecular formula C19H21FINO2 and a molecular weight of 441.28 g/mol. Its IUPAC name is 1-(2-fluoro-5-methoxyphenyl)-4-(4-iodophenoxy)-3-methylpiperidine.
| Compound Name | 1-(2-fluoro-5-methoxyphenyl)-4-(4-iodophenoxy)-3-methylpiperidine |
|---|---|
| PubChem CID | 142726683 |
| Molecular Formula | C19H21FINO2 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 1-(2-fluoro-5-methoxyphenyl)-4-(4-iodophenoxy)-3-methylpiperidine |
| SMILES | COc1ccc(F)c(N2CCC(Oc3ccc(I)cc3)C(C)C2)c1 |
| InChI | InChI=1S/C19H21FINO2/c1-13-12-22(18-11-16(23-2)7-8-17(18)20)10-9-19(13)24-15-5-3-14(21)4-6-15/h3-8,11,13,19H,9-10,12H2,1-2H3 |
| InChIKey | VHMMJSWJFVZBKP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|