C15H16F3N3O — CID 141409366
(2S)-1,2-dimethyl-7-[(3,4,5-trifluorophenyl)methoxy]-3,5-dihydro-2H-imidazo[1,2-c]pyrimidine (PubChem CID 141409366) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-7-[(3,4,5-trifluorophenyl)methoxy]-3,5-dihydro-2H-imidazo[1,2-c]pyrimidine.
| Compound Name | (2S)-1,2-dimethyl-7-[(3,4,5-trifluorophenyl)methoxy]-3,5-dihydro-2H-imidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 141409366 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S)-1,2-dimethyl-7-[(3,4,5-trifluorophenyl)methoxy]-3,5-dihydro-2H-imidazo[1,2-c]pyrimidine |
| SMILES | C[C@H]1CN2CN=C(OCc3cc(F)c(F)c(F)c3)C=C2N1C |
| InChI | InChI=1S/C15H16F3N3O/c1-9-6-21-8-19-13(5-14(21)20(9)2)22-7-10-3-11(16)15(18)12(17)4-10/h3-5,9H,6-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | ZDSLZTJACIEZJE-VIFPVBQESA-N |
| XLogP | 2.47 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|