C22H16FN7OS2 — CID 141410000
N-[4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide (PubChem CID 141410000) has the molecular formula C22H16FN7OS2 and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide.
| Compound Name | N-[4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 141410000 |
| Molecular Formula | C22H16FN7OS2 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[4-[2,6-dimethyl-4-(7H-purin-6-ylsulfanyl)phenyl]-1,3-thiazol-2-yl]-2-fluoropyridine-4-carboxamide |
| SMILES | Cc1cc(Sc2ncnc3nc[nH]c23)cc(C)c1-c1csc(NC(=O)c2ccnc(F)c2)n1 |
| InChI | InChI=1S/C22H16FN7OS2/c1-11-5-14(33-21-18-19(26-9-25-18)27-10-28-21)6-12(2)17(11)15-8-32-22(29-15)30-20(31)13-3-4-24-16(23)7-13/h3-10H,1-2H3,(H,29,30,31)(H,25,26,27,28) |
| InChIKey | MICGVJHTSFPWCU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|