C16H13FO5 — CID 141414677
6-(2-carboxyphenyl)-6-fluoro-5-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141414677) has the molecular formula C16H13FO5 and a molecular weight of 304.27 g/mol. Its IUPAC name is 6-(2-carboxyphenyl)-6-fluoro-5-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 6-(2-carboxyphenyl)-6-fluoro-5-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141414677 |
| Molecular Formula | C16H13FO5 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 6-(2-carboxyphenyl)-6-fluoro-5-(2-oxoethyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=CCC1=CC=CC(C(=O)O)C1(F)c1ccccc1C(=O)O |
| InChI | InChI=1S/C16H13FO5/c17-16(12-6-2-1-5-11(12)14(19)20)10(8-9-18)4-3-7-13(16)15(21)22/h1-7,9,13H,8H2,(H,19,20)(H,21,22) |
| InChIKey | QZUKEKKDNMEBPA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|