C13H22NOS+ — CID 141415323
trimethyl-[3-(2-methyl-4-sulfanylphenoxy)propyl]azanium (PubChem CID 141415323) has the molecular formula C13H22NOS+ and a molecular weight of 240.39 g/mol. Its IUPAC name is trimethyl-[3-(2-methyl-4-sulfanylphenoxy)propyl]azanium.
| Compound Name | trimethyl-[3-(2-methyl-4-sulfanylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 141415323 |
| Molecular Formula | C13H22NOS+ |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | trimethyl-[3-(2-methyl-4-sulfanylphenoxy)propyl]azanium |
| SMILES | Cc1cc(S)ccc1OCCC[N+](C)(C)C |
| InChI | InChI=1S/C13H21NOS/c1-11-10-12(16)6-7-13(11)15-9-5-8-14(2,3)4/h6-7,10H,5,8-9H2,1-4H3/p+1 |
| InChIKey | WYUIXYYGVNRPQZ-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|