About [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol
[(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol (PubChem CID 141417336) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol.
Analyze [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol?
The IUPAC name of [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol (CID 141417336) is [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol.
What is the SMILES notation for [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol?
The canonical SMILES for [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol is CC1=CN[C@H](CO)C1.
What is the InChIKey of [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol?
The InChIKey is FZWQGZDXQUCCFS-LURJTMIESA-N. The full InChI is InChI=1S/C6H11NO/c1-5-2-6(4-8)7-3-5/h3,6-8H,2,4H2,1H3/t6-/m0/s1.
What are the key properties of [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol?
[(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol has a molecular weight of 113.16 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-methyl-2,3-dihydro-1H-pyrrol-2-yl]methanol is sourced from PubChem (CID 141417336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).