C6H11NO — CID 154406268
(4-methyl-2,3-dihydro-1H-pyrrol-2-yl)methanol (PubChem CID 154406268) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (4-methyl-2,3-dihydro-1H-pyrrol-2-yl)methanol.
| Compound Name | (4-methyl-2,3-dihydro-1H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 154406268 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (4-methyl-2,3-dihydro-1H-pyrrol-2-yl)methanol |
| SMILES | CC1=CNC(CO)C1 |
| InChI | InChI=1S/C6H11NO/c1-5-2-6(4-8)7-3-5/h3,6-8H,2,4H2,1H3 |
| InChIKey | FZWQGZDXQUCCFS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |