C18H42N2O6Si2 — CID 141420285
1,2-bis(3-trimethoxysilylpropyl)cyclohexane-1,2-diamine (PubChem CID 141420285) has the molecular formula C18H42N2O6Si2 and a molecular weight of 438.71 g/mol. Its IUPAC name is 1,2-bis(3-trimethoxysilylpropyl)cyclohexane-1,2-diamine.
| Compound Name | 1,2-bis(3-trimethoxysilylpropyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 141420285 |
| Molecular Formula | C18H42N2O6Si2 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1,2-bis(3-trimethoxysilylpropyl)cyclohexane-1,2-diamine |
| SMILES | CO[Si](CCCC1(N)CCCCC1(N)CCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C18H42N2O6Si2/c1-21-27(22-2,23-3)15-9-13-17(19)11-7-8-12-18(17,20)14-10-16-28(24-4,25-5)26-6/h7-16,19-20H2,1-6H3 |
| InChIKey | HJIICMMUVGNLML-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|