C7H6O4 — CID 141425191
4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde (PubChem CID 141425191) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde.
| Compound Name | 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 141425191 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carbaldehyde |
| SMILES | O=CC12C=CC(O)=C(O)C1O2 |
| InChI | InChI=1S/C7H6O4/c8-3-7-2-1-4(9)5(10)6(7)11-7/h1-3,6,9-10H |
| InChIKey | OMEPVJVHCTWZKM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|