C7H6O4 — CID 141109529
4-hydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 141109529) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 4-hydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
| Compound Name | 4-hydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141109529 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 4-hydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C12C=CC(O)=CC1O2 |
| InChI | InChI=1S/C7H6O4/c8-4-1-2-7(6(9)10)5(3-4)11-7/h1-3,5,8H,(H,9,10) |
| InChIKey | UNOSTFHDBCIIEK-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|