C18H16N2O3 — CID 141428166
2',3'-dioxo-1-phenylspiro[2,5,6,8-tetrahydroquinoline-7,1'-cyclopropane]-3-carboxamide (PubChem CID 141428166) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2',3'-dioxo-1-phenylspiro[2,5,6,8-tetrahydroquinoline-7,1'-cyclopropane]-3-carboxamide.
| Compound Name | 2',3'-dioxo-1-phenylspiro[2,5,6,8-tetrahydroquinoline-7,1'-cyclopropane]-3-carboxamide |
|---|---|
| PubChem CID | 141428166 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2',3'-dioxo-1-phenylspiro[2,5,6,8-tetrahydroquinoline-7,1'-cyclopropane]-3-carboxamide |
| SMILES | NC(=O)C1=CC2=C(CC3(CC2)C(=O)C3=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C18H16N2O3/c19-17(23)12-8-11-6-7-18(15(21)16(18)22)9-14(11)20(10-12)13-4-2-1-3-5-13/h1-5,8H,6-7,9-10H2,(H2,19,23) |
| InChIKey | MNFFSRUKOOWZII-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|