C22H36O4 — CID 141430444
bis(2,2-dimethylpropyl) 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 141430444) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is bis(2,2-dimethylpropyl) 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(2,2-dimethylpropyl) 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141430444 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | bis(2,2-dimethylpropyl) 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCC1(C(=O)OCC(C)(C)C)C2C=CC(C2)C1C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C22H36O4/c1-8-11-22(19(24)26-14-21(5,6)7)16-10-9-15(12-16)17(22)18(23)25-13-20(2,3)4/h9-10,15-17H,8,11-14H2,1-7H3 |
| InChIKey | VMEMMXJXAWBIDH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|