C18H28O4 — CID 141430456
dipropan-2-yl 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 141430456) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is dipropan-2-yl 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dipropan-2-yl 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141430456 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | dipropan-2-yl 2-propylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCC1(C(=O)OC(C)C)C2C=CC(C2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C18H28O4/c1-6-9-18(17(20)22-12(4)5)14-8-7-13(10-14)15(18)16(19)21-11(2)3/h7-8,11-15H,6,9-10H2,1-5H3 |
| InChIKey | ZBZQDDRJBBZTRU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|